Sativanine B
chemical compound
Press Enter · cited answer in seconds
0 sources
Sativanine B
Summary
Sativanine B is a group of stereoisomers[1].
Key Facts
- Sativanine B's instance of is recorded as group of stereoisomers[2].
- Sativanine B's canonical SMILES is recorded as CCCCC1C(=O)N(CN1C)C2C(OC3=CC=C(C=C3)C=CNC(=O)C(NC2=O)C(C)C)C4=CC=CC=C4[3].
- Sativanine B's chemical formula is recorded as C₃₀H₃₈N₄O₄[4].
- Sativanine B is a type of chemical compound[5].
- Sativanine B's isomeric SMILES is recorded as CCCCC1C(=O)N(CN1C)[C@H]2C@HC4=CC=CC=C4C@HC4=CC=CC=C4">[6].
- Sativanine B's mass is recorded as {'unit': 'http://www.wikidata.org/entity/Q483261', 'amount': '+518.289306'}[7].