Isotan B
chemical compound
Press Enter · cited answer in seconds
0 sources
Isotan B
Summary
Isotan B is a group of stereoisomers[1].
Key Facts
- Isotan B's instance of is recorded as group of stereoisomers[2].
- Isotan B's canonical SMILES is recorded as C1=CC=C2C(=C1)C(=CN2)OC(=O)C3C(C(C(O3)(CO)O)O)O[3].
- Isotan B's chemical formula is recorded as C₁₄H₁₅NO₇[4].
- Isotan B is a type of chemical compound[5].
- Isotan B's isomeric SMILES is recorded as C1=CC=C2C(=C1)C(=CN2)OC(=O)C3C@HOC@HO">[6].
- Isotan B's mass is recorded as {'unit': 'http://www.wikidata.org/entity/Q483261', 'amount': '+309.084852'}[7].