bis-triazole derivative 10
chemical compound
Press Enter · cited answer in seconds
0 sources
bis-triazole derivative 10
Summary
bis-triazole derivative 10 is a group of stereoisomers[1].
Key Facts
- bis-triazole derivative 10's instance of is recorded as group of stereoisomers[2].
- bis-triazole derivative 10's canonical SMILES is recorded as C1C(C(=O)NC(CC2=CN(CC3=CC=CC(=C3)CN4C=C1N=N4)N=N2)C(=O)NCC5=CC=C(C=C5)C(=N)N)NS(=O)(=O)CC6=CC=CC=C6[3].
- bis-triazole derivative 10's chemical formula is recorded as C₃₃H₃₅N₁₁O₄S[4].
- bis-triazole derivative 10 is a type of chemical compound[5].
- bis-triazole derivative 10's isomeric SMILES is recorded as C1C@HNS(=O)(=O)CC6=CC=CC=C6C@HNS(=O)(=O)CC6=CC=CC=C6">[6].
- bis-triazole derivative 10's mass is recorded as {'unit': 'http://www.wikidata.org/entity/Q483261', 'amount': '+681.25942'}[7].